C17H18N4O3S — CID 58967446
2-(2,4-dioxo-1H-quinazolin-3-yl)-4-methyl-N-(1,3-thiazol-2-yl)pentanamide (PubChem CID 58967446) has the molecular formula C17H18N4O3S and a molecular weight of 358.42 g/mol. Its IUPAC name is 2-(2,4-dioxo-1H-quinazolin-3-yl)-4-methyl-N-(1,3-thiazol-2-yl)pentanamide.
| Compound Name | 2-(2,4-dioxo-1H-quinazolin-3-yl)-4-methyl-N-(1,3-thiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 58967446 |
| Molecular Formula | C17H18N4O3S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 2-(2,4-dioxo-1H-quinazolin-3-yl)-4-methyl-N-(1,3-thiazol-2-yl)pentanamide |
| SMILES | CC(C)CC(C(=O)Nc1nccs1)n1c(=O)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C17H18N4O3S/c1-10(2)9-13(14(22)20-16-18-7-8-25-16)21-15(23)11-5-3-4-6-12(11)19-17(21)24/h3-8,10,13H,9H2,1-2H3,(H,19,24)(H,18,20,22) |
| InChIKey | BQMHATOCVWTFBK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |