C23H34N2O2 — CID 58967679
4-[1-[3-(4-propoxypiperidin-1-yl)propyl]indol-3-yl]butan-2-one (PubChem CID 58967679) has the molecular formula C23H34N2O2 and a molecular weight of 370.54 g/mol. Its IUPAC name is 4-[1-[3-(4-propoxypiperidin-1-yl)propyl]indol-3-yl]butan-2-one.
| Compound Name | 4-[1-[3-(4-propoxypiperidin-1-yl)propyl]indol-3-yl]butan-2-one |
|---|---|
| PubChem CID | 58967679 |
| Molecular Formula | C23H34N2O2 |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.26 |
| IUPAC Name | 4-[1-[3-(4-propoxypiperidin-1-yl)propyl]indol-3-yl]butan-2-one |
| SMILES | CCCOC1CCN(CCCn2cc(CCC(C)=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C23H34N2O2/c1-3-17-27-21-11-15-24(16-12-21)13-6-14-25-18-20(10-9-19(2)26)22-7-4-5-8-23(22)25/h4-5,7-8,18,21H,3,6,9-17H2,1-2H3 |
| InChIKey | GKISKSNEYHMQRC-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |