C22H32N2O3 — CID 58968235
1-[4-methoxy-1-[3-(4-propoxypiperidin-1-yl)propyl]indol-3-yl]ethanone (PubChem CID 58968235) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is 1-[4-methoxy-1-[3-(4-propoxypiperidin-1-yl)propyl]indol-3-yl]ethanone.
| Compound Name | 1-[4-methoxy-1-[3-(4-propoxypiperidin-1-yl)propyl]indol-3-yl]ethanone |
|---|---|
| PubChem CID | 58968235 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 1-[4-methoxy-1-[3-(4-propoxypiperidin-1-yl)propyl]indol-3-yl]ethanone |
| SMILES | CCCOC1CCN(CCCn2cc(C(C)=O)c3c(OC)cccc32)CC1 |
| InChI | InChI=1S/C22H32N2O3/c1-4-15-27-18-9-13-23(14-10-18)11-6-12-24-16-19(17(2)25)22-20(24)7-5-8-21(22)26-3/h5,7-8,16,18H,4,6,9-15H2,1-3H3 |
| InChIKey | MEXKTDNORAXYNP-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |