C25H36N2O2 — CID 58967725
[1-[3-(4-butylpiperidin-1-yl)propyl]-7-methoxyindol-3-yl]-cyclopropylmethanone (PubChem CID 58967725) has the molecular formula C25H36N2O2 and a molecular weight of 396.58 g/mol. Its IUPAC name is [1-[3-(4-butylpiperidin-1-yl)propyl]-7-methoxyindol-3-yl]-cyclopropylmethanone.
| Compound Name | [1-[3-(4-butylpiperidin-1-yl)propyl]-7-methoxyindol-3-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 58967725 |
| Molecular Formula | C25H36N2O2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | [1-[3-(4-butylpiperidin-1-yl)propyl]-7-methoxyindol-3-yl]-cyclopropylmethanone |
| SMILES | CCCCC1CCN(CCCn2cc(C(=O)C3CC3)c3cccc(OC)c32)CC1 |
| InChI | InChI=1S/C25H36N2O2/c1-3-4-7-19-12-16-26(17-13-19)14-6-15-27-18-22(25(28)20-10-11-20)21-8-5-9-23(29-2)24(21)27/h5,8-9,18-20H,3-4,6-7,10-17H2,1-2H3 |
| InChIKey | PBSBGVBCISFEHM-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |