C30H41ClN2O3 — CID 143502826
2-(chloromethyl)but-1-ene;cyclopropyl-[7-hydroxy-1-[3-[4-[(3Z)-penta-1,3-dien-2-yl]oxypiperidin-1-yl]propyl]indol-3-yl]methanone (PubChem CID 143502826) has the molecular formula C30H41ClN2O3 and a molecular weight of 513.12 g/mol. Its IUPAC name is 2-(chloromethyl)but-1-ene;cyclopropyl-[7-hydroxy-1-[3-[4-[(3Z)-penta-1,3-dien-2-yl]oxypiperidin-1-yl]propyl]indol-3-yl]methanone.
| Compound Name | 2-(chloromethyl)but-1-ene;cyclopropyl-[7-hydroxy-1-[3-[4-[(3Z)-penta-1,3-dien-2-yl]oxypiperidin-1-yl]propyl]indol-3-yl]methanone |
|---|---|
| PubChem CID | 143502826 |
| Molecular Formula | C30H41ClN2O3 |
| Molecular Weight | 513.12 g/mol |
| Exact Mass | 512.28 |
| IUPAC Name | 2-(chloromethyl)but-1-ene;cyclopropyl-[7-hydroxy-1-[3-[4-[(3Z)-penta-1,3-dien-2-yl]oxypiperidin-1-yl]propyl]indol-3-yl]methanone |
| SMILES | C=C(/C=C\C)OC1CCN(CCCn2cc(C(=O)C3CC3)c3cccc(O)c32)CC1.C=C(CC)CCl |
| InChI | InChI=1S/C25H32N2O3.C5H9Cl/c1-3-6-18(2)30-20-11-15-26(16-12-20)13-5-14-27-17-22(25(29)19-9-10-19)21-7-4-8-23(28)24(21)27;1-3-5(2)4-6/h3-4,6-8,17,19-20,28H,2,5,9-16H2,1H3;2-4H2,1H3/b6-3-; |
| InChIKey | DCTDWMSUGLNDPS-AQPBACSKSA-N |
| XLogP | 7.09 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.12 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|