C20H25N5O4 — CID 58972934
tert-butyl N-[7-(azidomethyl)isoquinolin-1-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 58972934) has the molecular formula C20H25N5O4 and a molecular weight of 399.45 g/mol. Its IUPAC name is tert-butyl N-[7-(azidomethyl)isoquinolin-1-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-[7-(azidomethyl)isoquinolin-1-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 58972934 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | tert-butyl N-[7-(azidomethyl)isoquinolin-1-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)c1nccc2ccc(CN=[N+]=[N-])cc12 |
| InChI | InChI=1S/C20H25N5O4/c1-19(2,3)28-17(26)25(18(27)29-20(4,5)6)16-15-11-13(12-23-24-21)7-8-14(15)9-10-22-16/h7-11H,12H2,1-6H3 |
| InChIKey | SZSTVHHYLFOOAN-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 117.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|