C26H18ClFN2O3S2 — CID 58975196
4-[3-(5-chlorothiophen-2-yl)indol-1-yl]sulfonyl-N-[(4-fluorophenyl)methyl]benzamide (PubChem CID 58975196) has the molecular formula C26H18ClFN2O3S2 and a molecular weight of 525.03 g/mol. Its IUPAC name is 4-[3-(5-chlorothiophen-2-yl)indol-1-yl]sulfonyl-N-[(4-fluorophenyl)methyl]benzamide.
| Compound Name | 4-[3-(5-chlorothiophen-2-yl)indol-1-yl]sulfonyl-N-[(4-fluorophenyl)methyl]benzamide |
|---|---|
| PubChem CID | 58975196 |
| Molecular Formula | C26H18ClFN2O3S2 |
| Molecular Weight | 525.03 g/mol |
| Exact Mass | 524.04 |
| IUPAC Name | 4-[3-(5-chlorothiophen-2-yl)indol-1-yl]sulfonyl-N-[(4-fluorophenyl)methyl]benzamide |
| SMILES | O=C(NCc1ccc(F)cc1)c1ccc(S(=O)(=O)n2cc(-c3ccc(Cl)s3)c3ccccc32)cc1 |
| InChI | InChI=1S/C26H18ClFN2O3S2/c27-25-14-13-24(34-25)22-16-30(23-4-2-1-3-21(22)23)35(32,33)20-11-7-18(8-12-20)26(31)29-15-17-5-9-19(28)10-6-17/h1-14,16H,15H2,(H,29,31) |
| InChIKey | SPXTYJGJKXHZJR-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.03 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |