C18H22N6O3 — CID 58976489
1-(4,6-dimethyl-2-pyridinyl)-3-N-(3,4,5-trimethoxyphenyl)-1,2,4-triazole-3,5-diamine (PubChem CID 58976489) has the molecular formula C18H22N6O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 1-(4,6-dimethyl-2-pyridinyl)-3-N-(3,4,5-trimethoxyphenyl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-(4,6-dimethyl-2-pyridinyl)-3-N-(3,4,5-trimethoxyphenyl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 58976489 |
| Molecular Formula | C18H22N6O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1-(4,6-dimethyl-2-pyridinyl)-3-N-(3,4,5-trimethoxyphenyl)-1,2,4-triazole-3,5-diamine |
| SMILES | COc1cc(Nc2nc(N)n(-c3cc(C)cc(C)n3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C18H22N6O3/c1-10-6-11(2)20-15(7-10)24-17(19)22-18(23-24)21-12-8-13(25-3)16(27-5)14(9-12)26-4/h6-9H,1-5H3,(H3,19,21,22,23) |
| InChIKey | KESSBWKJPMGZTM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |