C18H17FN6O3S — CID 58975985
1-(6-fluoro-1,3-benzothiazol-2-yl)-3-N-(3,4,5-trimethoxyphenyl)-1,2,4-triazole-3,5-diamine (PubChem CID 58975985) has the molecular formula C18H17FN6O3S and a molecular weight of 416.44 g/mol. Its IUPAC name is 1-(6-fluoro-1,3-benzothiazol-2-yl)-3-N-(3,4,5-trimethoxyphenyl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-(6-fluoro-1,3-benzothiazol-2-yl)-3-N-(3,4,5-trimethoxyphenyl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 58975985 |
| Molecular Formula | C18H17FN6O3S |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 1-(6-fluoro-1,3-benzothiazol-2-yl)-3-N-(3,4,5-trimethoxyphenyl)-1,2,4-triazole-3,5-diamine |
| SMILES | COc1cc(Nc2nc(N)n(-c3nc4ccc(F)cc4s3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C18H17FN6O3S/c1-26-12-7-10(8-13(27-2)15(12)28-3)21-17-23-16(20)25(24-17)18-22-11-5-4-9(19)6-14(11)29-18/h4-8H,1-3H3,(H3,20,21,23,24) |
| InChIKey | VFOJMTRKHRMHPI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 109.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |