C19H20N6O4S — CID 58975996
1-(4-methoxy-1,3-benzothiazol-2-yl)-5-N-(3,4,5-trimethoxyphenyl)-1,2,4-triazole-3,5-diamine (PubChem CID 58975996) has the molecular formula C19H20N6O4S and a molecular weight of 428.47 g/mol. Its IUPAC name is 1-(4-methoxy-1,3-benzothiazol-2-yl)-5-N-(3,4,5-trimethoxyphenyl)-1,2,4-triazole-3,5-diamine.
| Compound Name | 1-(4-methoxy-1,3-benzothiazol-2-yl)-5-N-(3,4,5-trimethoxyphenyl)-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 58975996 |
| Molecular Formula | C19H20N6O4S |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 1-(4-methoxy-1,3-benzothiazol-2-yl)-5-N-(3,4,5-trimethoxyphenyl)-1,2,4-triazole-3,5-diamine |
| SMILES | COc1cc(Nc2nc(N)nn2-c2nc3c(OC)cccc3s2)cc(OC)c1OC |
| InChI | InChI=1S/C19H20N6O4S/c1-26-11-6-5-7-14-15(11)22-19(30-14)25-18(23-17(20)24-25)21-10-8-12(27-2)16(29-4)13(9-10)28-3/h5-9H,1-4H3,(H3,20,21,23,24) |
| InChIKey | WMLSGSIBGKDORO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |