C22H27N7O4S — CID 58976853
4-[[2-[5-amino-3-(3,4,5-trimethoxyanilino)-1,2,4-triazol-1-yl]-1,3-benzothiazol-6-yl]amino]butan-1-ol (PubChem CID 58976853) has the molecular formula C22H27N7O4S and a molecular weight of 485.57 g/mol. Its IUPAC name is 4-[[2-[5-amino-3-(3,4,5-trimethoxyanilino)-1,2,4-triazol-1-yl]-1,3-benzothiazol-6-yl]amino]butan-1-ol.
| Compound Name | 4-[[2-[5-amino-3-(3,4,5-trimethoxyanilino)-1,2,4-triazol-1-yl]-1,3-benzothiazol-6-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 58976853 |
| Molecular Formula | C22H27N7O4S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | 4-[[2-[5-amino-3-(3,4,5-trimethoxyanilino)-1,2,4-triazol-1-yl]-1,3-benzothiazol-6-yl]amino]butan-1-ol |
| SMILES | COc1cc(Nc2nc(N)n(-c3nc4ccc(NCCCCO)cc4s3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C22H27N7O4S/c1-31-16-10-14(11-17(32-2)19(16)33-3)25-21-27-20(23)29(28-21)22-26-15-7-6-13(12-18(15)34-22)24-8-4-5-9-30/h6-7,10-12,24,30H,4-5,8-9H2,1-3H3,(H3,23,25,27,28) |
| InChIKey | UNPIGIIYTRAADT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 141.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|