C22H22N2O5 — CID 58977385
3-O-methyl 1-O-phenyl (3R,4S)-4-[[3-(isocyanomethoxy)phenyl]methyl]pyrrolidine-1,3-dicarboxylate (PubChem CID 58977385) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is 3-O-methyl 1-O-phenyl (3R,4S)-4-[[3-(isocyanomethoxy)phenyl]methyl]pyrrolidine-1,3-dicarboxylate.
| Compound Name | 3-O-methyl 1-O-phenyl (3R,4S)-4-[[3-(isocyanomethoxy)phenyl]methyl]pyrrolidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 58977385 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 3-O-methyl 1-O-phenyl (3R,4S)-4-[[3-(isocyanomethoxy)phenyl]methyl]pyrrolidine-1,3-dicarboxylate |
| SMILES | [C-]#[N+]COc1cccc(C[C@@H]2CN(C(=O)Oc3ccccc3)C[C@@H]2C(=O)OC)c1 |
| InChI | InChI=1S/C22H22N2O5/c1-23-15-28-19-10-6-7-16(12-19)11-17-13-24(14-20(17)21(25)27-2)22(26)29-18-8-4-3-5-9-18/h3-10,12,17,20H,11,13-15H2,2H3/t17-,20+/m1/s1 |
| InChIKey | CLSYCUBINRWYCJ-XLIONFOSSA-N |
| XLogP | 3.40 |
| TPSA | 69.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|