C30H28N2O5 — CID 88942973
phenyl (3R,4S)-3-formyl-4-[[3-[2-(2-phenyl-1,3-oxazol-5-yl)ethoxy]phenyl]methyl]pyrrolidine-1-carboxylate (PubChem CID 88942973) has the molecular formula C30H28N2O5 and a molecular weight of 496.56 g/mol. Its IUPAC name is phenyl (3R,4S)-3-formyl-4-[[3-[2-(2-phenyl-1,3-oxazol-5-yl)ethoxy]phenyl]methyl]pyrrolidine-1-carboxylate.
| Compound Name | phenyl (3R,4S)-3-formyl-4-[[3-[2-(2-phenyl-1,3-oxazol-5-yl)ethoxy]phenyl]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 88942973 |
| Molecular Formula | C30H28N2O5 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | phenyl (3R,4S)-3-formyl-4-[[3-[2-(2-phenyl-1,3-oxazol-5-yl)ethoxy]phenyl]methyl]pyrrolidine-1-carboxylate |
| SMILES | O=C[C@H]1CN(C(=O)Oc2ccccc2)C[C@H]1Cc1cccc(OCCc2cnc(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C30H28N2O5/c33-21-25-20-32(30(34)37-26-11-5-2-6-12-26)19-24(25)16-22-8-7-13-27(17-22)35-15-14-28-18-31-29(36-28)23-9-3-1-4-10-23/h1-13,17-18,21,24-25H,14-16,19-20H2/t24-,25-/m1/s1 |
| InChIKey | GGIQUNQOLQQMOK-JWQCQUIFSA-N |
| XLogP | 5.45 |
| TPSA | 81.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|