C21H25ClN6 — CID 58978048
N-(4-tert-butylphenyl)-4-(3-chloro-2-pyridinyl)-N'-isocyanopiperazine-1-carboximidamide (PubChem CID 58978048) has the molecular formula C21H25ClN6 and a molecular weight of 396.93 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-4-(3-chloro-2-pyridinyl)-N'-isocyanopiperazine-1-carboximidamide.
| Compound Name | N-(4-tert-butylphenyl)-4-(3-chloro-2-pyridinyl)-N'-isocyanopiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 58978048 |
| Molecular Formula | C21H25ClN6 |
| Molecular Weight | 396.93 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | N-(4-tert-butylphenyl)-4-(3-chloro-2-pyridinyl)-N'-isocyanopiperazine-1-carboximidamide |
| SMILES | [C-]#[N+]/N=C(/Nc1ccc(C(C)(C)C)cc1)N1CCN(c2ncccc2Cl)CC1 |
| InChI | InChI=1S/C21H25ClN6/c1-21(2,3)16-7-9-17(10-8-16)25-20(26-23-4)28-14-12-27(13-15-28)19-18(22)6-5-11-24-19/h5-11H,12-15H2,1-3H3,(H,25,26) |
| InChIKey | OCZMFWNQUXLWQQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.93 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|