C19H30O5Si — CID 58979178
2-trimethylsilylethyl 5-hydroxy-2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]benzoate (PubChem CID 58979178) has the molecular formula C19H30O5Si and a molecular weight of 366.53 g/mol. Its IUPAC name is 2-trimethylsilylethyl 5-hydroxy-2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]benzoate.
| Compound Name | 2-trimethylsilylethyl 5-hydroxy-2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]benzoate |
|---|---|
| PubChem CID | 58979178 |
| Molecular Formula | C19H30O5Si |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 2-trimethylsilylethyl 5-hydroxy-2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]benzoate |
| SMILES | CC(C)(C)OC(=O)CCc1ccc(O)cc1C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C19H30O5Si/c1-19(2,3)24-17(21)10-8-14-7-9-15(20)13-16(14)18(22)23-11-12-25(4,5)6/h7,9,13,20H,8,10-12H2,1-6H3 |
| InChIKey | KVDYXOSYZBESMA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|