C15H22O3 — CID 58798427
tert-butyl 3-[2-methyl-5-(tritiooxymethyl)phenyl]propanoate (PubChem CID 58798427) has the molecular formula C15H22O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is tert-butyl 3-[2-methyl-5-(tritiooxymethyl)phenyl]propanoate.
| Compound Name | tert-butyl 3-[2-methyl-5-(tritiooxymethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 58798427 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | tert-butyl 3-[2-methyl-5-(tritiooxymethyl)phenyl]propanoate |
| SMILES | [3H]OCc1ccc(C)c(CCC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C15H22O3/c1-11-5-6-12(10-16)9-13(11)7-8-14(17)18-15(2,3)4/h5-6,9,16H,7-8,10H2,1-4H3/i16T |
| InChIKey | KTMGMFZVRWWVPK-TZLORFPWSA-N |
| XLogP | 2.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |