C27H18N4 — CID 58979984
12-isocyano-8,8-bis(4-methylphenyl)-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile (PubChem CID 58979984) has the molecular formula C27H18N4 and a molecular weight of 398.47 g/mol. Its IUPAC name is 12-isocyano-8,8-bis(4-methylphenyl)-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile.
| Compound Name | 12-isocyano-8,8-bis(4-methylphenyl)-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 58979984 |
| Molecular Formula | C27H18N4 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 12-isocyano-8,8-bis(4-methylphenyl)-3,13-diazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
| SMILES | [C-]#[N+]c1ccc2c(n1)-c1nc(C#N)ccc1C2(c1ccc(C)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H18N4/c1-17-4-8-19(9-5-17)27(20-10-6-18(2)7-11-20)22-13-12-21(16-28)30-25(22)26-23(27)14-15-24(29-3)31-26/h4-15H,1-2H3 |
| InChIKey | UPFZLNSMOSSAFH-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 53.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|