C34H24F6O4 — CID 58982792
5-[1,1,1,3,3,3-hexafluoro-2-(7-methyl-2-oxo-3-phenyl-3H-1-benzofuran-5-yl)propan-2-yl]-4,7-dimethyl-3-phenyl-3H-1-benzofuran-2-one (PubChem CID 58982792) has the molecular formula C34H24F6O4 and a molecular weight of 610.55 g/mol. Its IUPAC name is 5-[1,1,1,3,3,3-hexafluoro-2-(7-methyl-2-oxo-3-phenyl-3H-1-benzofuran-5-yl)propan-2-yl]-4,7-dimethyl-3-phenyl-3H-1-benzofuran-2-one.
| Compound Name | 5-[1,1,1,3,3,3-hexafluoro-2-(7-methyl-2-oxo-3-phenyl-3H-1-benzofuran-5-yl)propan-2-yl]-4,7-dimethyl-3-phenyl-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 58982792 |
| Molecular Formula | C34H24F6O4 |
| Molecular Weight | 610.55 g/mol |
| Exact Mass | 610.16 |
| IUPAC Name | 5-[1,1,1,3,3,3-hexafluoro-2-(7-methyl-2-oxo-3-phenyl-3H-1-benzofuran-5-yl)propan-2-yl]-4,7-dimethyl-3-phenyl-3H-1-benzofuran-2-one |
| SMILES | Cc1cc(C(c2cc(C)c3c(c2C)C(c2ccccc2)C(=O)O3)(C(F)(F)F)C(F)(F)F)cc2c1OC(=O)C2c1ccccc1 |
| InChI | InChI=1S/C34H24F6O4/c1-17-14-22(16-23-26(30(41)43-28(17)23)20-10-6-4-7-11-20)32(33(35,36)37,34(38,39)40)24-15-18(2)29-25(19(24)3)27(31(42)44-29)21-12-8-5-9-13-21/h4-16,26-27H,1-3H3 |
| InChIKey | AOSOXVDWTNBQFU-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.55 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|