C14H10F2K2O8S3 — CID 58983861
dipotassium;[5-fluoro-2-[4-fluoro-2-(oxidoperoxysulfanylmethyl)phenyl]sulfonylphenyl]methanesulfonate (PubChem CID 58983861) has the molecular formula C14H10F2K2O8S3 and a molecular weight of 518.62 g/mol. Its IUPAC name is dipotassium;[5-fluoro-2-[4-fluoro-2-(oxidoperoxysulfanylmethyl)phenyl]sulfonylphenyl]methanesulfonate.
| Compound Name | dipotassium;[5-fluoro-2-[4-fluoro-2-(oxidoperoxysulfanylmethyl)phenyl]sulfonylphenyl]methanesulfonate |
|---|---|
| PubChem CID | 58983861 |
| Molecular Formula | C14H10F2K2O8S3 |
| Molecular Weight | 518.62 g/mol |
| Exact Mass | 517.88 |
| IUPAC Name | dipotassium;[5-fluoro-2-[4-fluoro-2-(oxidoperoxysulfanylmethyl)phenyl]sulfonylphenyl]methanesulfonate |
| SMILES | O=S(=O)([O-])Cc1cc(F)ccc1S(=O)(=O)c1ccc(F)cc1CSOO[O-].[K+].[K+] |
| InChI | InChI=1S/C14H12F2O8S3.2K/c15-11-1-3-13(9(5-11)7-25-24-23-17)27(21,22)14-4-2-12(16)6-10(14)8-26(18,19)20;;/h1-6,17H,7-8H2,(H,18,19,20);;/q;2*+1/p-2 |
| InChIKey | PNMJXZSNMRNCIF-UHFFFAOYSA-L |
| XLogP | -4.78 |
| TPSA | 132.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.62 |
| LogP ≤ 5 | -4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|