C12H7F2KO5S2 — CID 142697327
potassium 3-(2,4-difluorophenyl)sulfonylbenzenesulfonate (PubChem CID 142697327) has the molecular formula C12H7F2KO5S2 and a molecular weight of 372.41 g/mol. Its IUPAC name is potassium 3-(2,4-difluorophenyl)sulfonylbenzenesulfonate.
| Compound Name | potassium 3-(2,4-difluorophenyl)sulfonylbenzenesulfonate |
|---|---|
| PubChem CID | 142697327 |
| Molecular Formula | C12H7F2KO5S2 |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 371.93 |
| IUPAC Name | potassium 3-(2,4-difluorophenyl)sulfonylbenzenesulfonate |
| SMILES | O=S(=O)([O-])c1cccc(S(=O)(=O)c2ccc(F)cc2F)c1.[K+] |
| InChI | InChI=1S/C12H8F2O5S2.K/c13-8-4-5-12(11(14)6-8)20(15,16)9-2-1-3-10(7-9)21(17,18)19;/h1-7H,(H,17,18,19);/q;+1/p-1 |
| InChIKey | FAJFKTJJBWVGPF-UHFFFAOYSA-M |
| XLogP | -1.29 |
| TPSA | 91.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|