C20H15F3O2S — CID 21099422
2,4-difluoro-1-[2-[4-(2-fluorophenyl)sulfonylphenyl]ethyl]benzene (PubChem CID 21099422) has the molecular formula C20H15F3O2S and a molecular weight of 376.40 g/mol. Its IUPAC name is 2,4-difluoro-1-[2-[4-(2-fluorophenyl)sulfonylphenyl]ethyl]benzene.
| Compound Name | 2,4-difluoro-1-[2-[4-(2-fluorophenyl)sulfonylphenyl]ethyl]benzene |
|---|---|
| PubChem CID | 21099422 |
| Molecular Formula | C20H15F3O2S |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 2,4-difluoro-1-[2-[4-(2-fluorophenyl)sulfonylphenyl]ethyl]benzene |
| SMILES | O=S(=O)(c1ccc(CCc2ccc(F)cc2F)cc1)c1ccccc1F |
| InChI | InChI=1S/C20H15F3O2S/c21-16-10-9-15(19(23)13-16)8-5-14-6-11-17(12-7-14)26(24,25)20-4-2-1-3-18(20)22/h1-4,6-7,9-13H,5,8H2 |
| InChIKey | VEHUFJFCBRYCCZ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |