C19H14F3NO2S — CID 21099406
2-[2-(2,4-difluorophenyl)ethyl]-5-(2-fluorophenyl)sulfonylpyridine (PubChem CID 21099406) has the molecular formula C19H14F3NO2S and a molecular weight of 377.39 g/mol. Its IUPAC name is 2-[2-(2,4-difluorophenyl)ethyl]-5-(2-fluorophenyl)sulfonylpyridine.
| Compound Name | 2-[2-(2,4-difluorophenyl)ethyl]-5-(2-fluorophenyl)sulfonylpyridine |
|---|---|
| PubChem CID | 21099406 |
| Molecular Formula | C19H14F3NO2S |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 2-[2-(2,4-difluorophenyl)ethyl]-5-(2-fluorophenyl)sulfonylpyridine |
| SMILES | O=S(=O)(c1ccc(CCc2ccc(F)cc2F)nc1)c1ccccc1F |
| InChI | InChI=1S/C19H14F3NO2S/c20-14-7-5-13(18(22)11-14)6-8-15-9-10-16(12-23-15)26(24,25)19-4-2-1-3-17(19)21/h1-5,7,9-12H,6,8H2 |
| InChIKey | HKZVZTXFVJPIGU-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |