C10H12F2O3S2 — CID 172688672
2,4-difluorobenzenesulfonate;thiolan-1-ium (PubChem CID 172688672) has the molecular formula C10H12F2O3S2 and a molecular weight of 282.33 g/mol. Its IUPAC name is 2,4-difluorobenzenesulfonate;thiolan-1-ium.
| Compound Name | 2,4-difluorobenzenesulfonate;thiolan-1-ium |
|---|---|
| PubChem CID | 172688672 |
| Molecular Formula | C10H12F2O3S2 |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 2,4-difluorobenzenesulfonate;thiolan-1-ium |
| SMILES | C1CC[SH+]C1.O=S(=O)([O-])c1ccc(F)cc1F |
| InChI | InChI=1S/C6H4F2O3S.C4H8S/c7-4-1-2-6(5(8)3-4)12(9,10)11;1-2-4-5-3-1/h1-3H,(H,9,10,11);1-4H2 |
| InChIKey | BJLLQADOSMHVBW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|