C11H6BrF2NO2S — CID 166624903
2-bromo-4-(2,4-difluorophenyl)sulfonylpyridine (PubChem CID 166624903) has the molecular formula C11H6BrF2NO2S and a molecular weight of 334.14 g/mol. Its IUPAC name is 2-bromo-4-(2,4-difluorophenyl)sulfonylpyridine.
| Compound Name | 2-bromo-4-(2,4-difluorophenyl)sulfonylpyridine |
|---|---|
| PubChem CID | 166624903 |
| Molecular Formula | C11H6BrF2NO2S |
| Molecular Weight | 334.14 g/mol |
| Exact Mass | 332.93 |
| IUPAC Name | 2-bromo-4-(2,4-difluorophenyl)sulfonylpyridine |
| SMILES | O=S(=O)(c1ccnc(Br)c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H6BrF2NO2S/c12-11-6-8(3-4-15-11)18(16,17)10-2-1-7(13)5-9(10)14/h1-6H |
| InChIKey | GRZPMKHNEUIVSS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.14 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|