C22H25FN2O4 — CID 58989927
methyl 5-[[2-(cyclopentylmethoxycarbamoyl)anilino]methyl]-2-fluorobenzoate (PubChem CID 58989927) has the molecular formula C22H25FN2O4 and a molecular weight of 400.45 g/mol. Its IUPAC name is methyl 5-[[2-(cyclopentylmethoxycarbamoyl)anilino]methyl]-2-fluorobenzoate.
| Compound Name | methyl 5-[[2-(cyclopentylmethoxycarbamoyl)anilino]methyl]-2-fluorobenzoate |
|---|---|
| PubChem CID | 58989927 |
| Molecular Formula | C22H25FN2O4 |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | methyl 5-[[2-(cyclopentylmethoxycarbamoyl)anilino]methyl]-2-fluorobenzoate |
| SMILES | COC(=O)c1cc(CNc2ccccc2C(=O)NOCC2CCCC2)ccc1F |
| InChI | InChI=1S/C22H25FN2O4/c1-28-22(27)18-12-16(10-11-19(18)23)13-24-20-9-5-4-8-17(20)21(26)25-29-14-15-6-2-3-7-15/h4-5,8-12,15,24H,2-3,6-7,13-14H2,1H3,(H,25,26) |
| InChIKey | RXSHNYLVVQDWIF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|