C21H27N5O2S — CID 44553843
N-(cyclopentylmethoxy)-2-[[2-(methylcarbamothioylamino)-4-pyridinyl]methylamino]benzamide (PubChem CID 44553843) has the molecular formula C21H27N5O2S and a molecular weight of 413.55 g/mol. Its IUPAC name is N-(cyclopentylmethoxy)-2-[[2-(methylcarbamothioylamino)-4-pyridinyl]methylamino]benzamide.
| Compound Name | N-(cyclopentylmethoxy)-2-[[2-(methylcarbamothioylamino)-4-pyridinyl]methylamino]benzamide |
|---|---|
| PubChem CID | 44553843 |
| Molecular Formula | C21H27N5O2S |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N-(cyclopentylmethoxy)-2-[[2-(methylcarbamothioylamino)-4-pyridinyl]methylamino]benzamide |
| SMILES | CNC(=S)Nc1cc(CNc2ccccc2C(=O)NOCC2CCCC2)ccn1 |
| InChI | InChI=1S/C21H27N5O2S/c1-22-21(29)25-19-12-16(10-11-23-19)13-24-18-9-5-4-8-17(18)20(27)26-28-14-15-6-2-3-7-15/h4-5,8-12,15,24H,2-3,6-7,13-14H2,1H3,(H,26,27)(H2,22,23,25,29) |
| InChIKey | XQDOZNHITRYUFL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 87.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|