C24H31N5O3 — CID 149254025
N-[4-[[2-(cyclopentylmethoxycarbamoyl)anilino]methyl]-2-pyridinyl]pyrrolidine-2-carboxamide (PubChem CID 149254025) has the molecular formula C24H31N5O3 and a molecular weight of 437.54 g/mol. Its IUPAC name is N-[4-[[2-(cyclopentylmethoxycarbamoyl)anilino]methyl]-2-pyridinyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[4-[[2-(cyclopentylmethoxycarbamoyl)anilino]methyl]-2-pyridinyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 149254025 |
| Molecular Formula | C24H31N5O3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | N-[4-[[2-(cyclopentylmethoxycarbamoyl)anilino]methyl]-2-pyridinyl]pyrrolidine-2-carboxamide |
| SMILES | O=C(NOCC1CCCC1)c1ccccc1NCc1ccnc(NC(=O)C2CCCN2)c1 |
| InChI | InChI=1S/C24H31N5O3/c30-23(29-32-16-17-6-1-2-7-17)19-8-3-4-9-20(19)27-15-18-11-13-26-22(14-18)28-24(31)21-10-5-12-25-21/h3-4,8-9,11,13-14,17,21,25,27H,1-2,5-7,10,12,15-16H2,(H,29,30)(H,26,28,31) |
| InChIKey | ZOBBJDUVUZHLDG-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 104.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|