C24H31N5O5 — CID 87281983
ethyl 2-[[4-[[2-[cyclopentyl(methoxy)carbamoyl]anilino]methyl]-2-pyridinyl]carbamoylamino]acetate (PubChem CID 87281983) has the molecular formula C24H31N5O5 and a molecular weight of 469.54 g/mol. Its IUPAC name is ethyl 2-[[4-[[2-[cyclopentyl(methoxy)carbamoyl]anilino]methyl]-2-pyridinyl]carbamoylamino]acetate.
| Compound Name | ethyl 2-[[4-[[2-[cyclopentyl(methoxy)carbamoyl]anilino]methyl]-2-pyridinyl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 87281983 |
| Molecular Formula | C24H31N5O5 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | ethyl 2-[[4-[[2-[cyclopentyl(methoxy)carbamoyl]anilino]methyl]-2-pyridinyl]carbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)Nc1cc(CNc2ccccc2C(=O)N(OC)C2CCCC2)ccn1 |
| InChI | InChI=1S/C24H31N5O5/c1-3-34-22(30)16-27-24(32)28-21-14-17(12-13-25-21)15-26-20-11-7-6-10-19(20)23(31)29(33-2)18-8-4-5-9-18/h6-7,10-14,18,26H,3-5,8-9,15-16H2,1-2H3,(H2,25,27,28,32) |
| InChIKey | WXJOINVFZRWGDS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 121.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|