C26H35N5O3 — CID 142686227
3-amino-2-[[2-(cyclohexylcarbamoylamino)-4-pyridinyl]methyl]-N-(cyclopentylmethoxy)benzamide (PubChem CID 142686227) has the molecular formula C26H35N5O3 and a molecular weight of 465.60 g/mol. Its IUPAC name is 3-amino-2-[[2-(cyclohexylcarbamoylamino)-4-pyridinyl]methyl]-N-(cyclopentylmethoxy)benzamide.
| Compound Name | 3-amino-2-[[2-(cyclohexylcarbamoylamino)-4-pyridinyl]methyl]-N-(cyclopentylmethoxy)benzamide |
|---|---|
| PubChem CID | 142686227 |
| Molecular Formula | C26H35N5O3 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | 3-amino-2-[[2-(cyclohexylcarbamoylamino)-4-pyridinyl]methyl]-N-(cyclopentylmethoxy)benzamide |
| SMILES | Nc1cccc(C(=O)NOCC2CCCC2)c1Cc1ccnc(NC(=O)NC2CCCCC2)c1 |
| InChI | InChI=1S/C26H35N5O3/c27-23-12-6-11-21(25(32)31-34-17-18-7-4-5-8-18)22(23)15-19-13-14-28-24(16-19)30-26(33)29-20-9-2-1-3-10-20/h6,11-14,16,18,20H,1-5,7-10,15,17,27H2,(H,31,32)(H2,28,29,30,33) |
| InChIKey | GLNDIXIIABMNBA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|