C22H20N4O2S — CID 58989956
N-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2-(quinolin-4-ylmethylamino)benzamide (PubChem CID 58989956) has the molecular formula C22H20N4O2S and a molecular weight of 404.50 g/mol. Its IUPAC name is N-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2-(quinolin-4-ylmethylamino)benzamide.
| Compound Name | N-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2-(quinolin-4-ylmethylamino)benzamide |
|---|---|
| PubChem CID | 58989956 |
| Molecular Formula | C22H20N4O2S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | N-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2-(quinolin-4-ylmethylamino)benzamide |
| SMILES | Cc1nc(CONC(=O)c2ccccc2NCc2ccnc3ccccc23)cs1 |
| InChI | InChI=1S/C22H20N4O2S/c1-15-25-17(14-29-15)13-28-26-22(27)19-7-3-5-9-21(19)24-12-16-10-11-23-20-8-4-2-6-18(16)20/h2-11,14,24H,12-13H2,1H3,(H,26,27) |
| InChIKey | NRLFVSCRUVRKRT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|