C18H18N4O2S — CID 87281943
N-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2-(pyridin-2-ylmethylamino)benzamide (PubChem CID 87281943) has the molecular formula C18H18N4O2S and a molecular weight of 354.44 g/mol. Its IUPAC name is N-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2-(pyridin-2-ylmethylamino)benzamide.
| Compound Name | N-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2-(pyridin-2-ylmethylamino)benzamide |
|---|---|
| PubChem CID | 87281943 |
| Molecular Formula | C18H18N4O2S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-[(2-methyl-1,3-thiazol-4-yl)methoxy]-2-(pyridin-2-ylmethylamino)benzamide |
| SMILES | Cc1nc(CONC(=O)c2ccccc2NCc2ccccn2)cs1 |
| InChI | InChI=1S/C18H18N4O2S/c1-13-21-15(12-25-13)11-24-22-18(23)16-7-2-3-8-17(16)20-10-14-6-4-5-9-19-14/h2-9,12,20H,10-11H2,1H3,(H,22,23) |
| InChIKey | LIUJEVHMEOAYSW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|