C9H9F3N2O3 — CID 58994197
4-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]butanal (PubChem CID 58994197) has the molecular formula C9H9F3N2O3 and a molecular weight of 250.18 g/mol. Its IUPAC name is 4-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]butanal.
| Compound Name | 4-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]butanal |
|---|---|
| PubChem CID | 58994197 |
| Molecular Formula | C9H9F3N2O3 |
| Molecular Weight | 250.18 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 4-[2,4-dioxo-5-(trifluoromethyl)pyrimidin-1-yl]butanal |
| SMILES | O=CCCCn1cc(C(F)(F)F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H9F3N2O3/c10-9(11,12)6-5-14(3-1-2-4-15)8(17)13-7(6)16/h4-5H,1-3H2,(H,13,16,17) |
| InChIKey | LDLPXYSLNFGDNY-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.18 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|