C15H19F5O3 — CID 58995477
[2-(1,1,3,3,3-pentafluoro-2-hydroxy-2-methylpropyl)-2-bicyclo[2.2.2]octanyl] prop-2-enoate (PubChem CID 58995477) has the molecular formula C15H19F5O3 and a molecular weight of 342.30 g/mol. Its IUPAC name is [2-(1,1,3,3,3-pentafluoro-2-hydroxy-2-methylpropyl)-2-bicyclo[2.2.2]octanyl] prop-2-enoate.
| Compound Name | [2-(1,1,3,3,3-pentafluoro-2-hydroxy-2-methylpropyl)-2-bicyclo[2.2.2]octanyl] prop-2-enoate |
|---|---|
| PubChem CID | 58995477 |
| Molecular Formula | C15H19F5O3 |
| Molecular Weight | 342.30 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | [2-(1,1,3,3,3-pentafluoro-2-hydroxy-2-methylpropyl)-2-bicyclo[2.2.2]octanyl] prop-2-enoate |
| SMILES | C=CC(=O)OC1(C(F)(F)C(C)(O)C(F)(F)F)CC2CCC1CC2 |
| InChI | InChI=1S/C15H19F5O3/c1-3-11(21)23-13(8-9-4-6-10(13)7-5-9)14(16,17)12(2,22)15(18,19)20/h3,9-10,22H,1,4-8H2,2H3 |
| InChIKey | VNRQXNHWLKZSOZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.30 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|