C11H17N5O6 — CID 58996356
(2R,3R,4S,5R)-2-[[6-(dimethylamino)-5-nitropyrimidin-4-yl]amino]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 58996356) has the molecular formula C11H17N5O6 and a molecular weight of 315.29 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[[6-(dimethylamino)-5-nitropyrimidin-4-yl]amino]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[[6-(dimethylamino)-5-nitropyrimidin-4-yl]amino]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 58996356 |
| Molecular Formula | C11H17N5O6 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | (2R,3R,4S,5R)-2-[[6-(dimethylamino)-5-nitropyrimidin-4-yl]amino]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CN(C)c1ncnc(N[C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H17N5O6/c1-15(2)10-6(16(20)21)9(12-4-13-10)14-11-8(19)7(18)5(3-17)22-11/h4-5,7-8,11,17-19H,3H2,1-2H3,(H,12,13,14)/t5-,7-,8-,11-/m1/s1 |
| InChIKey | MLZFXPFBPNMEMJ-IOSLPCCCSA-N |
| XLogP | -1.70 |
| TPSA | 154.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|