C11H15N5O7 — CID 11724091
[(2R,3S,4R,5R)-5-[(6-amino-5-nitropyrimidin-4-yl)amino]-3,4-dihydroxyoxolan-2-yl]methyl acetate (PubChem CID 11724091) has the molecular formula C11H15N5O7 and a molecular weight of 329.27 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-[(6-amino-5-nitropyrimidin-4-yl)amino]-3,4-dihydroxyoxolan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-5-[(6-amino-5-nitropyrimidin-4-yl)amino]-3,4-dihydroxyoxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11724091 |
| Molecular Formula | C11H15N5O7 |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | [(2R,3S,4R,5R)-5-[(6-amino-5-nitropyrimidin-4-yl)amino]-3,4-dihydroxyoxolan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](Nc2ncnc(N)c2[N+](=O)[O-])[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H15N5O7/c1-4(17)22-2-5-7(18)8(19)11(23-5)15-10-6(16(20)21)9(12)13-3-14-10/h3,5,7-8,11,18-19H,2H2,1H3,(H3,12,13,14,15)/t5-,7-,8-,11-/m1/s1 |
| InChIKey | IDDAXFAQVLQDOB-IOSLPCCCSA-N |
| XLogP | -1.61 |
| TPSA | 182.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|