C10H15N5O5 — CID 10265938
(1R,2S,3R,5R)-3-[(6-amino-5-nitropyrimidin-4-yl)amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 10265938) has the molecular formula C10H15N5O5 and a molecular weight of 285.26 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[(6-amino-5-nitropyrimidin-4-yl)amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[(6-amino-5-nitropyrimidin-4-yl)amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 10265938 |
| Molecular Formula | C10H15N5O5 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | (1R,2S,3R,5R)-3-[(6-amino-5-nitropyrimidin-4-yl)amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | Nc1ncnc(N[C@@H]2C[C@H](CO)[C@@H](O)[C@H]2O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H15N5O5/c11-9-6(15(19)20)10(13-3-12-9)14-5-1-4(2-16)7(17)8(5)18/h3-5,7-8,16-18H,1-2H2,(H3,11,12,13,14)/t4-,5-,7-,8+/m1/s1 |
| InChIKey | LVDRYANKICNCQL-APOSLCTFSA-N |
| XLogP | -1.52 |
| TPSA | 167.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|