C9H11F2N5O5 — CID 58996362
(2R,3S,5R)-2-[(6-amino-5-nitropyrimidin-4-yl)amino]-4,4-difluoro-5-(hydroxymethyl)oxolan-3-ol (PubChem CID 58996362) has the molecular formula C9H11F2N5O5 and a molecular weight of 307.21 g/mol. Its IUPAC name is (2R,3S,5R)-2-[(6-amino-5-nitropyrimidin-4-yl)amino]-4,4-difluoro-5-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-2-[(6-amino-5-nitropyrimidin-4-yl)amino]-4,4-difluoro-5-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 58996362 |
| Molecular Formula | C9H11F2N5O5 |
| Molecular Weight | 307.21 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | (2R,3S,5R)-2-[(6-amino-5-nitropyrimidin-4-yl)amino]-4,4-difluoro-5-(hydroxymethyl)oxolan-3-ol |
| SMILES | Nc1ncnc(N[C@@H]2O[C@H](CO)C(F)(F)[C@H]2O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11F2N5O5/c10-9(11)3(1-17)21-8(5(9)18)15-7-4(16(19)20)6(12)13-2-14-7/h2-3,5,8,17-18H,1H2,(H3,12,13,14,15)/t3-,5+,8-/m1/s1 |
| InChIKey | CNKNLISQTSQXDT-UWBRJAPDSA-N |
| XLogP | -0.91 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.21 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|