C12H19N5O3 — CID 143196372
(2R,3R,4S,5R)-2-[[6-amino-5-(ethylideneamino)pyrimidin-4-yl]amino]-5-ethyloxolane-3,4-diol (PubChem CID 143196372) has the molecular formula C12H19N5O3 and a molecular weight of 281.32 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[[6-amino-5-(ethylideneamino)pyrimidin-4-yl]amino]-5-ethyloxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[[6-amino-5-(ethylideneamino)pyrimidin-4-yl]amino]-5-ethyloxolane-3,4-diol |
|---|---|
| PubChem CID | 143196372 |
| Molecular Formula | C12H19N5O3 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | (2R,3R,4S,5R)-2-[[6-amino-5-(ethylideneamino)pyrimidin-4-yl]amino]-5-ethyloxolane-3,4-diol |
| SMILES | C/C=N/c1c(N)ncnc1N[C@@H]1O[C@H](CC)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H19N5O3/c1-3-6-8(18)9(19)12(20-6)17-11-7(14-4-2)10(13)15-5-16-11/h4-6,8-9,12,18-19H,3H2,1-2H3,(H3,13,15,16,17)/b14-4+/t6-,8-,9-,12-/m1/s1 |
| InChIKey | IDTQULWDKFCTJZ-QOYQAUPOSA-N |
| XLogP | 0.05 |
| TPSA | 125.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|