C14H18NO2Y- — CID 58999636
N-[(7-methyl-2,3,4,8-tetrahydrochromen-8-id-2-yl)methyl]propanamide;yttrium (PubChem CID 58999636) has the molecular formula C14H18NO2Y- and a molecular weight of 321.21 g/mol. Its IUPAC name is N-[(7-methyl-2,3,4,8-tetrahydrochromen-8-id-2-yl)methyl]propanamide;yttrium.
| Compound Name | N-[(7-methyl-2,3,4,8-tetrahydrochromen-8-id-2-yl)methyl]propanamide;yttrium |
|---|---|
| PubChem CID | 58999636 |
| Molecular Formula | C14H18NO2Y- |
| Molecular Weight | 321.21 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | N-[(7-methyl-2,3,4,8-tetrahydrochromen-8-id-2-yl)methyl]propanamide;yttrium |
| SMILES | CCC(=O)NCC1CCc2ccc(C)[c-]c2O1.[Y] |
| InChI | InChI=1S/C14H18NO2.Y/c1-3-14(16)15-9-12-7-6-11-5-4-10(2)8-13(11)17-12;/h4-5,12H,3,6-7,9H2,1-2H3,(H,15,16);/q-1; |
| InChIKey | KRWNYBIIXQHSPW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.21 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|