C14H20NO2Y- — CID 59060853
1-(2,3,4,6-tetrahydrochromen-6-id-2-ylmethylamino)butan-2-ol;yttrium (PubChem CID 59060853) has the molecular formula C14H20NO2Y- and a molecular weight of 323.23 g/mol. Its IUPAC name is 1-(2,3,4,6-tetrahydrochromen-6-id-2-ylmethylamino)butan-2-ol;yttrium.
| Compound Name | 1-(2,3,4,6-tetrahydrochromen-6-id-2-ylmethylamino)butan-2-ol;yttrium |
|---|---|
| PubChem CID | 59060853 |
| Molecular Formula | C14H20NO2Y- |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | 1-(2,3,4,6-tetrahydrochromen-6-id-2-ylmethylamino)butan-2-ol;yttrium |
| SMILES | CCC(O)CNCC1CCc2c[c-]ccc2O1.[Y] |
| InChI | InChI=1S/C14H20NO2.Y/c1-2-12(16)9-15-10-13-8-7-11-5-3-4-6-14(11)17-13;/h4-6,12-13,15-16H,2,7-10H2,1H3;/q-1; |
| InChIKey | BXFHLQRYTWCUCY-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|