C18H26N2O3 — CID 59000260
2-(4,5-dimethyl-4,5-dihydro-1,3-oxazol-2-yl)-N-[3-(2,4-dimethylphenoxy)propyl]acetamide (PubChem CID 59000260) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 2-(4,5-dimethyl-4,5-dihydro-1,3-oxazol-2-yl)-N-[3-(2,4-dimethylphenoxy)propyl]acetamide.
| Compound Name | 2-(4,5-dimethyl-4,5-dihydro-1,3-oxazol-2-yl)-N-[3-(2,4-dimethylphenoxy)propyl]acetamide |
|---|---|
| PubChem CID | 59000260 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 2-(4,5-dimethyl-4,5-dihydro-1,3-oxazol-2-yl)-N-[3-(2,4-dimethylphenoxy)propyl]acetamide |
| SMILES | Cc1ccc(OCCCNC(=O)CC2=NC(C)C(C)O2)c(C)c1 |
| InChI | InChI=1S/C18H26N2O3/c1-12-6-7-16(13(2)10-12)22-9-5-8-19-17(21)11-18-20-14(3)15(4)23-18/h6-7,10,14-15H,5,8-9,11H2,1-4H3,(H,19,21) |
| InChIKey | XOTOHDJTYSXVQH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|