C15H21N5O3 — CID 18716817
1-[3-(2,4-dimethylphenoxy)propyl]-3-[(3-methyl-1,2,4-oxadiazol-5-yl)amino]urea (PubChem CID 18716817) has the molecular formula C15H21N5O3 and a molecular weight of 319.37 g/mol. Its IUPAC name is 1-[3-(2,4-dimethylphenoxy)propyl]-3-[(3-methyl-1,2,4-oxadiazol-5-yl)amino]urea.
| Compound Name | 1-[3-(2,4-dimethylphenoxy)propyl]-3-[(3-methyl-1,2,4-oxadiazol-5-yl)amino]urea |
|---|---|
| PubChem CID | 18716817 |
| Molecular Formula | C15H21N5O3 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 1-[3-(2,4-dimethylphenoxy)propyl]-3-[(3-methyl-1,2,4-oxadiazol-5-yl)amino]urea |
| SMILES | Cc1ccc(OCCCNC(=O)NNc2nc(C)no2)c(C)c1 |
| InChI | InChI=1S/C15H21N5O3/c1-10-5-6-13(11(2)9-10)22-8-4-7-16-14(21)18-19-15-17-12(3)20-23-15/h5-6,9H,4,7-8H2,1-3H3,(H2,16,18,21)(H,17,19,20) |
| InChIKey | UYKLMFHAPTVVSJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|