C21H22ClN5O2 — CID 54352577
1-(2-chloro-4,5-diisocyanoanilino)-3-[4-(2,4-dimethylphenoxy)butyl]urea (PubChem CID 54352577) has the molecular formula C21H22ClN5O2 and a molecular weight of 411.89 g/mol. Its IUPAC name is 1-(2-chloro-4,5-diisocyanoanilino)-3-[4-(2,4-dimethylphenoxy)butyl]urea.
| Compound Name | 1-(2-chloro-4,5-diisocyanoanilino)-3-[4-(2,4-dimethylphenoxy)butyl]urea |
|---|---|
| PubChem CID | 54352577 |
| Molecular Formula | C21H22ClN5O2 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 1-(2-chloro-4,5-diisocyanoanilino)-3-[4-(2,4-dimethylphenoxy)butyl]urea |
| SMILES | [C-]#[N+]c1cc(Cl)c(NNC(=O)NCCCCOc2ccc(C)cc2C)cc1[N+]#[C-] |
| InChI | InChI=1S/C21H22ClN5O2/c1-14-7-8-20(15(2)11-14)29-10-6-5-9-25-21(28)27-26-17-13-19(24-4)18(23-3)12-16(17)22/h7-8,11-13,26H,5-6,9-10H2,1-2H3,(H2,25,27,28) |
| InChIKey | OOETXHPQMLQLLY-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|