C17H22N6O2 — CID 18716911
1-[(4-cyano-1-methylpyrazol-5-yl)amino]-3-[3-(2,4-dimethylphenoxy)propyl]urea (PubChem CID 18716911) has the molecular formula C17H22N6O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 1-[(4-cyano-1-methylpyrazol-5-yl)amino]-3-[3-(2,4-dimethylphenoxy)propyl]urea.
| Compound Name | 1-[(4-cyano-1-methylpyrazol-5-yl)amino]-3-[3-(2,4-dimethylphenoxy)propyl]urea |
|---|---|
| PubChem CID | 18716911 |
| Molecular Formula | C17H22N6O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 1-[(4-cyano-1-methylpyrazol-5-yl)amino]-3-[3-(2,4-dimethylphenoxy)propyl]urea |
| SMILES | Cc1ccc(OCCCNC(=O)NNc2c(C#N)cnn2C)c(C)c1 |
| InChI | InChI=1S/C17H22N6O2/c1-12-5-6-15(13(2)9-12)25-8-4-7-19-17(24)22-21-16-14(10-18)11-20-23(16)3/h5-6,9,11,21H,4,7-8H2,1-3H3,(H2,19,22,24) |
| InChIKey | XQTYXAOVSSJYDG-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 104.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|