C28H29N7O6 — CID 91159290
1-(4,5-dicyano-2-methylanilino)-3-[3-(2,4-dimethylphenoxy)propyl]urea;1-methyl-2,4-dinitrobenzene (PubChem CID 91159290) has the molecular formula C28H29N7O6 and a molecular weight of 559.58 g/mol. Its IUPAC name is 1-(4,5-dicyano-2-methylanilino)-3-[3-(2,4-dimethylphenoxy)propyl]urea;1-methyl-2,4-dinitrobenzene.
| Compound Name | 1-(4,5-dicyano-2-methylanilino)-3-[3-(2,4-dimethylphenoxy)propyl]urea;1-methyl-2,4-dinitrobenzene |
|---|---|
| PubChem CID | 91159290 |
| Molecular Formula | C28H29N7O6 |
| Molecular Weight | 559.58 g/mol |
| Exact Mass | 559.22 |
| IUPAC Name | 1-(4,5-dicyano-2-methylanilino)-3-[3-(2,4-dimethylphenoxy)propyl]urea;1-methyl-2,4-dinitrobenzene |
| SMILES | Cc1ccc(OCCCNC(=O)NNc2cc(C#N)c(C#N)cc2C)c(C)c1.Cc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H23N5O2.C7H6N2O4/c1-14-5-6-20(16(3)9-14)28-8-4-7-24-21(27)26-25-19-11-18(13-23)17(12-22)10-15(19)2;1-5-2-3-6(8(10)11)4-7(5)9(12)13/h5-6,9-11,25H,4,7-8H2,1-3H3,(H2,24,26,27);2-4H,1H3 |
| InChIKey | JEBDOXKYTKPVRT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 196.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|