C15H21N5O3S — CID 59057856
1-[3-(2,4-dimethylphenoxy)propyl]-3-[(3-methylsulfanyl-1,2,4-oxadiazol-5-yl)amino]urea (PubChem CID 59057856) has the molecular formula C15H21N5O3S and a molecular weight of 351.43 g/mol. Its IUPAC name is 1-[3-(2,4-dimethylphenoxy)propyl]-3-[(3-methylsulfanyl-1,2,4-oxadiazol-5-yl)amino]urea.
| Compound Name | 1-[3-(2,4-dimethylphenoxy)propyl]-3-[(3-methylsulfanyl-1,2,4-oxadiazol-5-yl)amino]urea |
|---|---|
| PubChem CID | 59057856 |
| Molecular Formula | C15H21N5O3S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 1-[3-(2,4-dimethylphenoxy)propyl]-3-[(3-methylsulfanyl-1,2,4-oxadiazol-5-yl)amino]urea |
| SMILES | CSc1noc(NNC(=O)NCCCOc2ccc(C)cc2C)n1 |
| InChI | InChI=1S/C15H21N5O3S/c1-10-5-6-12(11(2)9-10)22-8-4-7-16-13(21)18-19-14-17-15(24-3)20-23-14/h5-6,9H,4,7-8H2,1-3H3,(H2,16,18,21)(H,17,19,20) |
| InChIKey | ZPSATFMPGZSHIX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|