C26H24F4N4O5 — CID 22895447
2-[[4-[3-(2,4-dimethylphenoxy)propylcarbamoylamino]anilino]carbamoyl]-3,4,5,6-tetrafluorobenzoic acid (PubChem CID 22895447) has the molecular formula C26H24F4N4O5 and a molecular weight of 548.49 g/mol. Its IUPAC name is 2-[[4-[3-(2,4-dimethylphenoxy)propylcarbamoylamino]anilino]carbamoyl]-3,4,5,6-tetrafluorobenzoic acid.
| Compound Name | 2-[[4-[3-(2,4-dimethylphenoxy)propylcarbamoylamino]anilino]carbamoyl]-3,4,5,6-tetrafluorobenzoic acid |
|---|---|
| PubChem CID | 22895447 |
| Molecular Formula | C26H24F4N4O5 |
| Molecular Weight | 548.49 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | 2-[[4-[3-(2,4-dimethylphenoxy)propylcarbamoylamino]anilino]carbamoyl]-3,4,5,6-tetrafluorobenzoic acid |
| SMILES | Cc1ccc(OCCCNC(=O)Nc2ccc(NNC(=O)c3c(F)c(F)c(F)c(F)c3C(=O)O)cc2)c(C)c1 |
| InChI | InChI=1S/C26H24F4N4O5/c1-13-4-9-17(14(2)12-13)39-11-3-10-31-26(38)32-15-5-7-16(8-6-15)33-34-24(35)18-19(25(36)37)21(28)23(30)22(29)20(18)27/h4-9,12,33H,3,10-11H2,1-2H3,(H,34,35)(H,36,37)(H2,31,32,38) |
| InChIKey | BNESQDAABGTGKE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.49 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|