C23H27N3O4 — CID 18725069
prop-2-ynyl 2-[2-[4-[4-(2,4-dimethylphenoxy)butylamino]phenyl]hydrazinyl]-2-oxoacetate (PubChem CID 18725069) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is prop-2-ynyl 2-[2-[4-[4-(2,4-dimethylphenoxy)butylamino]phenyl]hydrazinyl]-2-oxoacetate.
| Compound Name | prop-2-ynyl 2-[2-[4-[4-(2,4-dimethylphenoxy)butylamino]phenyl]hydrazinyl]-2-oxoacetate |
|---|---|
| PubChem CID | 18725069 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | prop-2-ynyl 2-[2-[4-[4-(2,4-dimethylphenoxy)butylamino]phenyl]hydrazinyl]-2-oxoacetate |
| SMILES | C#CCOC(=O)C(=O)NNc1ccc(NCCCCOc2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C23H27N3O4/c1-4-14-30-23(28)22(27)26-25-20-10-8-19(9-11-20)24-13-5-6-15-29-21-12-7-17(2)16-18(21)3/h1,7-12,16,24-25H,5-6,13-15H2,2-3H3,(H,26,27) |
| InChIKey | KLUYHQDDPRHGMV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|