C18H23N5O3 — CID 91100843
1-(1,2-dihydro-[1,3]oxazolo[5,4-b]pyridin-2-ylamino)-3-[3-(2,4-dimethylphenoxy)propyl]urea (PubChem CID 91100843) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is 1-(1,2-dihydro-[1,3]oxazolo[5,4-b]pyridin-2-ylamino)-3-[3-(2,4-dimethylphenoxy)propyl]urea.
| Compound Name | 1-(1,2-dihydro-[1,3]oxazolo[5,4-b]pyridin-2-ylamino)-3-[3-(2,4-dimethylphenoxy)propyl]urea |
|---|---|
| PubChem CID | 91100843 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 1-(1,2-dihydro-[1,3]oxazolo[5,4-b]pyridin-2-ylamino)-3-[3-(2,4-dimethylphenoxy)propyl]urea |
| SMILES | Cc1ccc(OCCCNC(=O)NNC2Nc3cccnc3O2)c(C)c1 |
| InChI | InChI=1S/C18H23N5O3/c1-12-6-7-15(13(2)11-12)25-10-4-9-20-17(24)22-23-18-21-14-5-3-8-19-16(14)26-18/h3,5-8,11,18,21,23H,4,9-10H2,1-2H3,(H2,20,22,24) |
| InChIKey | AUUWJTDMQWCYBO-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|