C9H17N3O3 — CID 59001687
N,N-bis(acetamidomethyl)propanamide (PubChem CID 59001687) has the molecular formula C9H17N3O3 and a molecular weight of 215.25 g/mol. Its IUPAC name is N,N-bis(acetamidomethyl)propanamide.
| Compound Name | N,N-bis(acetamidomethyl)propanamide |
|---|---|
| PubChem CID | 59001687 |
| Molecular Formula | C9H17N3O3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | N,N-bis(acetamidomethyl)propanamide |
| SMILES | CCC(=O)N(CNC(C)=O)CNC(C)=O |
| InChI | InChI=1S/C9H17N3O3/c1-4-9(15)12(5-10-7(2)13)6-11-8(3)14/h4-6H2,1-3H3,(H,10,13)(H,11,14) |
| InChIKey | GYSRINUYCXUTHF-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|